C21H35NO — CID 532921
N,N-dihexyl-3-phenylpropanamide (PubChem CID 532921) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is N,N-dihexyl-3-phenylpropanamide.
| Compound Name | N,N-dihexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 532921 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N,N-dihexyl-3-phenylpropanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H35NO/c1-3-5-7-12-18-22(19-13-8-6-4-2)21(23)17-16-20-14-10-9-11-15-20/h9-11,14-15H,3-8,12-13,16-19H2,1-2H3 |
| InChIKey | DWWGRGZSSZIIPB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|