About 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline
6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 5329280) has the molecular formula C16H10ClNO2
and a molecular weight of 283.71 g/mol. Its IUPAC name is 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline |
| PubChem CID | 5329280 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | Clc1nc2cc3c(cc2cc1-c1ccccc1)OCO3 |
| InChI | InChI=1S/C16H10ClNO2/c17-16-12(10-4-2-1-3-5-10)6-11-7-14-15(20-9-19-14)8-13(11)18-16/h1-8H,9H2 |
| InChIKey | TWSDEOXKXYWQFW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline?
The IUPAC name of 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline (CID 5329280) is 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline.
What is the SMILES notation for 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline?
The canonical SMILES for 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline is Clc1nc2cc3c(cc2cc1-c1ccccc1)OCO3.
What is the InChIKey of 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline?
The InChIKey is TWSDEOXKXYWQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClNO2/c17-16-12(10-4-2-1-3-5-10)6-11-7-14-15(20-9-19-14)8-13(11)18-16/h1-8H,9H2.
What are the key properties of 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline?
6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline has a molecular weight of 283.71 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-phenyl-[1,3]dioxolo[4,5-g]quinoline is sourced from PubChem (CID 5329280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).