C25H21N4O4S+ — CID 53292900
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide (PubChem CID 53292900) has the molecular formula C25H21N4O4S+ and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 53292900 |
| Molecular Formula | C25H21N4O4S+ |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1c(=O)o[nH][n+]1-c1ccccc1)C(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H20N4O4S/c1-2-21(34-24-25(31)33-28-29(24)18-8-4-3-5-9-18)22(30)26-17-14-12-16(13-15-17)23-27-19-10-6-7-11-20(19)32-23/h3-15,21H,2H2,1H3,(H-,26,27,28,30,31)/p+1 |
| InChIKey | XOIYCTFCSZNFAW-UHFFFAOYSA-O |
| XLogP | 4.56 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|