C14H24N2O3 — CID 5329298
(2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-ethenylpyrrolidine-2-carboxylic acid (PubChem CID 5329298) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-ethenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-ethenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5329298 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-ethenylpyrrolidine-2-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C14H24N2O3/c1-5-10-7-12(14(18)19)16-13(10)11(6-8(2)3)15-9(4)17/h5,8,10-13,16H,1,6-7H2,2-4H3,(H,15,17)(H,18,19)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | PHVNBKLWNINRKE-YVECIDJPSA-N |
| XLogP | 1.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|