C16H28N2O3 — CID 5329300
(2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-methylprop-1-enyl)pyrrolidine-2-carboxylic acid (PubChem CID 5329300) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-methylprop-1-enyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-methylprop-1-enyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5329300 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-methylprop-1-enyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1C=C(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-9(2)6-12-8-14(16(20)21)18-15(12)13(7-10(3)4)17-11(5)19/h6,10,12-15,18H,7-8H2,1-5H3,(H,17,19)(H,20,21)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | WBTMMKGCGSQAPB-LXTVHRRPSA-N |
| XLogP | 1.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|