About 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide
4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide (PubChem CID 5329331) has the molecular formula C15H17N7OS
and a molecular weight of 343.42 g/mol. Its IUPAC name is 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide |
| PubChem CID | 5329331 |
| Molecular Formula | C15H17N7OS |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide |
| SMILES | N#Cc1cnc(Nc2cc(CN3CCN(C(N)=O)CC3)ccn2)s1 |
| InChI | InChI=1S/C15H17N7OS/c16-8-12-9-19-15(24-12)20-13-7-11(1-2-18-13)10-21-3-5-22(6-4-21)14(17)23/h1-2,7,9H,3-6,10H2,(H2,17,23)(H,18,19,20) |
| InChIKey | USBODMLQZDZYEC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide?
The IUPAC name of 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide (CID 5329331) is 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide.
What is the SMILES notation for 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide?
The canonical SMILES for 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide is N#Cc1cnc(Nc2cc(CN3CCN(C(N)=O)CC3)ccn2)s1.
What is the InChIKey of 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide?
The InChIKey is USBODMLQZDZYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N7OS/c16-8-12-9-19-15(24-12)20-13-7-11(1-2-18-13)10-21-3-5-22(6-4-21)14(17)23/h1-2,7,9H,3-6,10H2,(H2,17,23)(H,18,19,20).
What are the key properties of 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide?
4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide has a molecular weight of 343.42 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazine-1-carboxamide is sourced from PubChem (CID 5329331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).