About 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole
5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole (PubChem CID 5329338) has the molecular formula C20H16N2O
and a molecular weight of 300.40 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-phenylbenzimidazole.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole |
| PubChem CID | 5329338 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-phenylbenzimidazole |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(C=C2)N(C=N3)C4=CC=CC=C4 |
| InChI | InChI=1S/C20H16N2O/c1-23-18-10-7-15(8-11-18)16-9-12-20-19(13-16)21-14-22(20)17-5-3-2-4-6-17/h2-14H,1H3 |
| InChIKey | OPGUZRRLMQSMAQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 374 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole?
The IUPAC name of 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole (CID 5329338) is 5-(4-methoxyphenyl)-1-phenylbenzimidazole.
What is the SMILES notation for 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole?
The canonical SMILES for 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole is COC1=CC=C(C=C1)C2=CC3=C(C=C2)N(C=N3)C4=CC=CC=C4.
What is the InChIKey of 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole?
The InChIKey is OPGUZRRLMQSMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O/c1-23-18-10-7-15(8-11-18)16-9-12-20-19(13-16)21-14-22(20)17-5-3-2-4-6-17/h2-14H,1H3.
What are the key properties of 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole?
5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole has a molecular weight of 300.40 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-1-phenyl-1H-1,3-benzodiazole is sourced from PubChem (CID 5329338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).