C19H15N3O — CID 5329343
3-(6-methoxy-3-pyridinyl)-7-phenylimidazo[1,2-a]pyridine (PubChem CID 5329343) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(6-methoxy-3-pyridinyl)-7-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-(6-methoxy-3-pyridinyl)-7-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 5329343 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(6-methoxy-3-pyridinyl)-7-phenylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cnc3cc(-c4ccccc4)ccn23)cn1 |
| InChI | InChI=1S/C19H15N3O/c1-23-19-8-7-16(12-21-19)17-13-20-18-11-15(9-10-22(17)18)14-5-3-2-4-6-14/h2-13H,1H3 |
| InChIKey | NNVZANSRDHCDLK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |