C24H23N5O6S — CID 53293959
(1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylethanimidate (PubChem CID 53293959) has the molecular formula C24H23N5O6S and a molecular weight of 509.54 g/mol. Its IUPAC name is (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylethanimidate.
| Compound Name | (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 53293959 |
| Molecular Formula | C24H23N5O6S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (1E)-N-(3-methyloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylethanimidate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1/N=C(SC/C([O-])=N\c2c[n+](C)no2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H23N5O6S/c1-28-13-22(35-27-28)26-21(30)14-36-24-25-17(23(31)29(24)16-8-6-5-7-9-16)10-15-11-19(33-3)20(34-4)12-18(15)32-2/h5-13H,14H2,1-4H3/b17-10+ |
| InChIKey | GAOGUTDURXLLDU-LICLKQGHSA-N |
| XLogP | 2.09 |
| TPSA | 125.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|