C15H13N3OS — CID 5329399
N-(6-methoxy-2-pyridinyl)-5-phenyl-1,3-thiazol-2-amine (PubChem CID 5329399) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is N-(6-methoxy-2-pyridinyl)-5-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(6-methoxy-2-pyridinyl)-5-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5329399 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(6-methoxy-2-pyridinyl)-5-phenyl-1,3-thiazol-2-amine |
| SMILES | COc1cccc(Nc2ncc(-c3ccccc3)s2)n1 |
| InChI | InChI=1S/C15H13N3OS/c1-19-14-9-5-8-13(17-14)18-15-16-10-12(20-15)11-6-3-2-4-7-11/h2-10H,1H3,(H,16,17,18) |
| InChIKey | KXCIGZYAUKVOFP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |