C15H14N8O2S — CID 53294436
(1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanimidate (PubChem CID 53294436) has the molecular formula C15H14N8O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanimidate.
| Compound Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanimidate |
|---|---|
| PubChem CID | 53294436 |
| Molecular Formula | C15H14N8O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanimidate |
| SMILES | CN(C)[n+]1cc(/N=C(/[O-])CSc2nnc3c(n2)[nH]c2ccccc23)on1 |
| InChI | InChI=1S/C15H14N8O2S/c1-22(2)23-7-12(25-21-23)17-11(24)8-26-15-18-14-13(19-20-15)9-5-3-4-6-10(9)16-14/h3-7H,8H2,1-2H3,(H-,16,17,18,19,20,21,24) |
| InChIKey | UIZMBXLADBLKQD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|