C19H15N7O2S — CID 53294440
(1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)ethanimidate (PubChem CID 53294440) has the molecular formula C19H15N7O2S and a molecular weight of 405.44 g/mol. Its IUPAC name is (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)ethanimidate.
| Compound Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)ethanimidate |
|---|---|
| PubChem CID | 53294440 |
| Molecular Formula | C19H15N7O2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (1E)-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)ethanimidate |
| SMILES | CN(C)[n+]1cc(/N=C(/[O-])CSc2nnc3c(n2)-c2cccc4cccc-3c24)on1 |
| InChI | InChI=1S/C19H15N7O2S/c1-25(2)26-9-15(28-24-26)20-14(27)10-29-19-21-17-12-7-3-5-11-6-4-8-13(16(11)12)18(17)22-23-19/h3-9H,10H2,1-2H3 |
| InChIKey | WBRMQFYDQSNYIE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|