C20H26N6O2S — CID 53294484
(1E)-2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53294484) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is (1E)-2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53294484 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (1E)-2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[3-(dimethylamino)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | CN(C)[n+]1cc(/N=C(/[O-])CSc2nc3c(cc2C#N)CC(C(C)(C)C)CC3)on1 |
| InChI | InChI=1S/C20H26N6O2S/c1-20(2,3)15-6-7-16-13(9-15)8-14(10-21)19(22-16)29-12-17(27)23-18-11-26(24-28-18)25(4)5/h8,11,15H,6-7,9,12H2,1-5H3 |
| InChIKey | NXHSTXLLZNDBES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|