About (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate
(1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53294740) has the molecular formula C13H17N5O2S
and a molecular weight of 307.38 g/mol. Its IUPAC name is (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate.
Molecular Properties
| Compound Name | (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate |
| PubChem CID | 53294740 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | Cc1cc(C)nc(SC/C([O-])=N\c2c[n+](C(C)C)no2)n1 |
| InChI | InChI=1S/C13H17N5O2S/c1-8(2)18-6-12(20-17-18)16-11(19)7-21-13-14-9(3)5-10(4)15-13/h5-6,8H,7H2,1-4H3 |
| InChIKey | QGCSCCPWDUZMEQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate?
The IUPAC name of (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate (CID 53294740) is (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate.
What is the SMILES notation for (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate?
The canonical SMILES for (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate is Cc1cc(C)nc(SC/C([O-])=N\c2c[n+](C(C)C)no2)n1.
What is the InChIKey of (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate?
The InChIKey is QGCSCCPWDUZMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2S/c1-8(2)18-6-12(20-17-18)16-11(19)7-21-13-14-9(3)5-10(4)15-13/h5-6,8H,7H2,1-4H3.
What are the key properties of (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate?
(1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate has a molecular weight of 307.38 g/mol, XLogP of 1.13, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate is sourced from PubChem (CID 53294740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).