C27H30N4O5S2 — CID 5329491
N-[4-(benzenesulfonyl)phenyl]-6-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine (PubChem CID 5329491) has the molecular formula C27H30N4O5S2 and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)phenyl]-6-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine.
| Compound Name | N-[4-(benzenesulfonyl)phenyl]-6-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 5329491 |
| Molecular Formula | C27H30N4O5S2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | N-[4-(benzenesulfonyl)phenyl]-6-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCCCCOc1ccc2ncnc(Nc3ccc(S(=O)(=O)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C27H30N4O5S2/c1-37(32,33)18-16-28-15-5-6-17-36-22-11-14-26-25(19-22)27(30-20-29-26)31-21-9-12-24(13-10-21)38(34,35)23-7-3-2-4-8-23/h2-4,7-14,19-20,28H,5-6,15-18H2,1H3,(H,29,30,31) |
| InChIKey | PEBATQNNPRRNAH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|