C24H24N6O2S — CID 53295162
(1E)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53295162) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is (1E)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53295162 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (1E)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | [O-]/C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)=N/c1c[n+](N2CCCCC2)no1 |
| InChI | InChI=1S/C24H24N6O2S/c31-20(25-21-16-30(28-32-21)29-14-8-3-9-15-29)17-33-24-26-22(18-10-4-1-5-11-18)23(27-24)19-12-6-2-7-13-19/h1-2,4-7,10-13,16H,3,8-9,14-15,17H2,(H-,25,26,27,28,31) |
| InChIKey | BDAMYLPIHFWSEN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|