C28H30N6O6S — CID 53295268
(1E)-2-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53295268) has the molecular formula C28H30N6O6S and a molecular weight of 578.65 g/mol. Its IUPAC name is (1E)-2-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53295268 |
| Molecular Formula | C28H30N6O6S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (1E)-2-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | COc1cc(/C=C2/N=C(SC/C([O-])=N\c3c[n+](N4CCCCC4)no3)N(c3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H30N6O6S/c1-37-22-15-19(16-23(38-2)26(22)39-3)14-21-27(36)34(20-10-6-4-7-11-20)28(29-21)41-18-24(35)30-25-17-33(31-40-25)32-12-8-5-9-13-32/h4,6-7,10-11,14-17H,5,8-9,12-13,18H2,1-3H3/b21-14+ |
| InChIKey | WLCMXLSSQJJFNY-KGENOOAVSA-N |
| XLogP | 2.68 |
| TPSA | 128.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|