C21H17F3N4O6 — CID 53295618
4-[[[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53295618) has the molecular formula C21H17F3N4O6 and a molecular weight of 478.38 g/mol. Its IUPAC name is 4-[[[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[[[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53295618 |
| Molecular Formula | C21H17F3N4O6 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-[[[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2CNC2CC(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H17F3N4O6/c1-32-14-6-4-13(5-7-14)28-17(20(31)34-26-28)11-25-16-10-18(29)27(19(16)30)12-2-8-15(9-3-12)33-21(22,23)24/h2-9,16,25H,10-11H2,1H3 |
| InChIKey | IERKPLKBLATYDO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|