C20H22N6O — CID 5329573
2-[4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenyl]acetonitrile (PubChem CID 5329573) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-[4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 5329573 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(Nc2nc(OCC3CCCCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C20H22N6O/c21-11-10-14-6-8-16(9-7-14)24-20-25-18-17(22-13-23-18)19(26-20)27-12-15-4-2-1-3-5-15/h6-9,13,15H,1-5,10,12H2,(H2,22,23,24,25,26) |
| InChIKey | WGZPMCYYUHLVCM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |