C13H19N5O4 — CID 5329586
methyl N-[2-amino-6-(cyclohexylmethoxy)-5-nitrosopyrimidin-4-yl]carbamate (PubChem CID 5329586) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl N-[2-amino-6-(cyclohexylmethoxy)-5-nitrosopyrimidin-4-yl]carbamate.
| Compound Name | methyl N-[2-amino-6-(cyclohexylmethoxy)-5-nitrosopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 5329586 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl N-[2-amino-6-(cyclohexylmethoxy)-5-nitrosopyrimidin-4-yl]carbamate |
| SMILES | COC(=O)Nc1nc(N)nc(OCC2CCCCC2)c1N=O |
| InChI | InChI=1S/C13H19N5O4/c1-21-13(19)16-10-9(18-20)11(17-12(14)15-10)22-7-8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H3,14,15,16,17,19) |
| InChIKey | PCHQRIWGWJCMKF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |