About (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine
(NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine (PubChem CID 5329591) has the molecular formula C12H19N5O2
and a molecular weight of 265.32 g/mol. Its IUPAC name is (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine |
| PubChem CID | 5329591 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine |
| SMILES | Nc1nc(N)c(/C=N/O)c(OCC2CCCCC2)n1 |
| InChI | InChI=1S/C12H19N5O2/c13-10-9(6-15-18)11(17-12(14)16-10)19-7-8-4-2-1-3-5-8/h6,8,18H,1-5,7H2,(H4,13,14,16,17)/b15-6+ |
| InChIKey | OZUCILPFVLGPOB-GIDUJCDVSA-N |
| XLogP | 1.41 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine (CID 5329591) is (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine is Nc1nc(N)c(/C=N/O)c(OCC2CCCCC2)n1.
What is the InChIKey of (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine?
The InChIKey is OZUCILPFVLGPOB-GIDUJCDVSA-N. The full InChI is InChI=1S/C12H19N5O2/c13-10-9(6-15-18)11(17-12(14)16-10)19-7-8-4-2-1-3-5-8/h6,8,18H,1-5,7H2,(H4,13,14,16,17)/b15-6+.
What are the key properties of (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine?
(NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine has a molecular weight of 265.32 g/mol, XLogP of 1.41, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[[2,4-diamino-6-(cyclohexylmethoxy)pyrimidin-5-yl]methylidene]hydroxylamine is sourced from PubChem (CID 5329591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).