About 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine
6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine (PubChem CID 5329593) has the molecular formula C19H25N5O2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine |
| PubChem CID | 5329593 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c(/C=N/OCc2ccccc2)c(OCC2CCCCC2)n1 |
| InChI | InChI=1S/C19H25N5O2/c20-17-16(11-22-26-13-15-9-5-2-6-10-15)18(24-19(21)23-17)25-12-14-7-3-1-4-8-14/h2,5-6,9-11,14H,1,3-4,7-8,12-13H2,(H4,20,21,23,24)/b22-11+ |
| InChIKey | CLJDKGFCOTWSGY-SSDVNMTOSA-N |
| XLogP | 3.15 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine?
The IUPAC name of 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine (CID 5329593) is 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine?
The canonical SMILES for 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine is Nc1nc(N)c(/C=N/OCc2ccccc2)c(OCC2CCCCC2)n1.
What is the InChIKey of 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine?
The InChIKey is CLJDKGFCOTWSGY-SSDVNMTOSA-N. The full InChI is InChI=1S/C19H25N5O2/c20-17-16(11-22-26-13-15-9-5-2-6-10-15)18(24-19(21)23-17)25-12-14-7-3-1-4-8-14/h2,5-6,9-11,14H,1,3-4,7-8,12-13H2,(H4,20,21,23,24)/b22-11+.
What are the key properties of 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine?
6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine has a molecular weight of 355.44 g/mol, XLogP of 3.15, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexylmethoxy)-5-[(E)-phenylmethoxyiminomethyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 5329593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).