C19H13N7O5S — CID 53296221
4-[2-amino-6-[2-(3-carboxyanilino)-2-oxoethyl]sulfanyl-3,5-dicyano-4-pyridinyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53296221) has the molecular formula C19H13N7O5S and a molecular weight of 451.42 g/mol. Its IUPAC name is 4-[2-amino-6-[2-(3-carboxyanilino)-2-oxoethyl]sulfanyl-3,5-dicyano-4-pyridinyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-amino-6-[2-(3-carboxyanilino)-2-oxoethyl]sulfanyl-3,5-dicyano-4-pyridinyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296221 |
| Molecular Formula | C19H13N7O5S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 4-[2-amino-6-[2-(3-carboxyanilino)-2-oxoethyl]sulfanyl-3,5-dicyano-4-pyridinyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1-c1c(C#N)c(N)nc(SCC(=O)Nc2cccc(C(=O)O)c2)c1C#N |
| InChI | InChI=1S/C19H13N7O5S/c1-26-15(19(30)31-25-26)14-11(6-20)16(22)24-17(12(14)7-21)32-8-13(27)23-10-4-2-3-9(5-10)18(28)29/h2-5H,8H2,1H3,(H4-,22,23,24,25,27,28,29,30) |
| InChIKey | LGPCPGYROILVOS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 205.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|