C23H14N6O3S — CID 53296505
4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53296505) has the molecular formula C23H14N6O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296505 |
| Molecular Formula | C23H14N6O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | N#Cc1c(N)nc2sc(C(=O)c3c([O-])on[n+]3-c3ccccc3)c(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C23H14N6O3S/c24-11-14-15(12-7-3-1-4-8-12)16-17(25)20(33-22(16)27-21(14)26)19(30)18-23(31)32-28-29(18)13-9-5-2-6-10-13/h1-10H,(H4-,25,26,27,28,30,31) |
| InChIKey | RXPSXUORBAYSDN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|