About [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea
[3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea (PubChem CID 5329658) has the molecular formula C15H10N4O3
and a molecular weight of 294.27 g/mol. Its IUPAC name is [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea.
Molecular Properties
| Compound Name | [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea |
| PubChem CID | 5329658 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea |
| SMILES | NC(=O)Nc1cccc2c1C(=O)c1c-2n[nH]c1-c1ccco1 |
| InChI | InChI=1S/C15H10N4O3/c16-15(21)17-8-4-1-3-7-10(8)14(20)11-12(7)18-19-13(11)9-5-2-6-22-9/h1-6H,(H,18,19)(H3,16,17,21) |
| InChIKey | YBPLYSSLKULVHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea?
The IUPAC name of [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea (CID 5329658) is [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea.
What is the SMILES notation for [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea?
The canonical SMILES for [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea is NC(=O)Nc1cccc2c1C(=O)c1c-2n[nH]c1-c1ccco1.
What is the InChIKey of [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea?
The InChIKey is YBPLYSSLKULVHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O3/c16-15(21)17-8-4-1-3-7-10(8)14(20)11-12(7)18-19-13(11)9-5-2-6-22-9/h1-6H,(H,18,19)(H3,16,17,21).
What are the key properties of [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea?
[3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea has a molecular weight of 294.27 g/mol, XLogP of 2.37, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(furan-2-yl)-4-oxo-2H-indeno[1,2-c]pyrazol-5-yl]urea is sourced from PubChem (CID 5329658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).