About [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea
[3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea (PubChem CID 5329659) has the molecular formula C16H13N5O2
and a molecular weight of 307.31 g/mol. Its IUPAC name is [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea.
Molecular Properties
| Compound Name | [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea |
| PubChem CID | 5329659 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea |
| SMILES | Cn1ccc(-c2n[nH]c3c2C(=O)c2c(NC(N)=O)cccc2-3)c1 |
| InChI | InChI=1S/C16H13N5O2/c1-21-6-5-8(7-21)13-12-14(20-19-13)9-3-2-4-10(18-16(17)23)11(9)15(12)22/h2-7H,1H3,(H,19,20)(H3,17,18,23) |
| InChIKey | UQBQAVMSJUVQLF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea?
The IUPAC name of [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea (CID 5329659) is [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea.
What is the SMILES notation for [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea?
The canonical SMILES for [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea is Cn1ccc(-c2n[nH]c3c2C(=O)c2c(NC(N)=O)cccc2-3)c1.
What is the InChIKey of [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea?
The InChIKey is UQBQAVMSJUVQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O2/c1-21-6-5-8(7-21)13-12-14(20-19-13)9-3-2-4-10(18-16(17)23)11(9)15(12)22/h2-7H,1H3,(H,19,20)(H3,17,18,23).
What are the key properties of [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea?
[3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea has a molecular weight of 307.31 g/mol, XLogP of 2.12, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methylpyrrol-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazol-5-yl]urea is sourced from PubChem (CID 5329659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).