C11H16N2O3S2 — CID 5329661
tert-butyl 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]acetate (PubChem CID 5329661) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]acetate.
| Compound Name | tert-butyl 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 5329661 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | tert-butyl 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]acetate |
| SMILES | CC(=O)Nc1ncc(SCC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-7(14)13-10-12-5-9(18-10)17-6-8(15)16-11(2,3)4/h5H,6H2,1-4H3,(H,12,13,14) |
| InChIKey | HOEMOEJHHVVLJW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |