About 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide
2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide (PubChem CID 5329682) has the molecular formula C10H15N3O2S2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide |
| PubChem CID | 5329682 |
| Molecular Formula | C10H15N3O2S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CSc1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C10H15N3O2S2/c1-4-13(3)8(15)6-16-9-5-11-10(17-9)12-7(2)14/h5H,4,6H2,1-3H3,(H,11,12,14) |
| InChIKey | ZKNPWGYBOBLIRC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide?
The IUPAC name of 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide (CID 5329682) is 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide.
What is the SMILES notation for 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide?
The canonical SMILES for 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide is CCN(C)C(=O)CSc1cnc(NC(C)=O)s1.
What is the InChIKey of 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide?
The InChIKey is ZKNPWGYBOBLIRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S2/c1-4-13(3)8(15)6-16-9-5-11-10(17-9)12-7(2)14/h5H,4,6H2,1-3H3,(H,11,12,14).
What are the key properties of 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide?
2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide has a molecular weight of 273.38 g/mol, XLogP of 1.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-acetamido-1,3-thiazol-5-yl)sulfanyl]-N-ethyl-N-methylacetamide is sourced from PubChem (CID 5329682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).