About N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide
N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 5329697) has the molecular formula C11H11N3OS2
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 5329697 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(SCc2ccccn2)s1 |
| InChI | InChI=1S/C11H11N3OS2/c1-8(15)14-11-13-6-10(17-11)16-7-9-4-2-3-5-12-9/h2-6H,7H2,1H3,(H,13,14,15) |
| InChIKey | QBIJITXIGVYJRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide (CID 5329697) is N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1ncc(SCc2ccccn2)s1.
What is the InChIKey of N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is QBIJITXIGVYJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS2/c1-8(15)14-11-13-6-10(17-11)16-7-9-4-2-3-5-12-9/h2-6H,7H2,1H3,(H,13,14,15).
What are the key properties of N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide?
N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 265.36 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(pyridin-2-ylmethylsulfanyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 5329697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).