About 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one
2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one (PubChem CID 5329713) has the molecular formula C17H21NO5S
and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one |
| PubChem CID | 5329713 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one |
| SMILES | CCSc1cc(=O)c2c(O)cc(O)c(C3CCN(C)CC3O)c2o1 |
| InChI | InChI=1S/C17H21NO5S/c1-3-24-14-7-12(21)16-11(20)6-10(19)15(17(16)23-14)9-4-5-18(2)8-13(9)22/h6-7,9,13,19-20,22H,3-5,8H2,1-2H3 |
| InChIKey | MXQMYWXBECXGHZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one?
The IUPAC name of 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one (CID 5329713) is 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one.
What is the SMILES notation for 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one?
The canonical SMILES for 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one is CCSc1cc(=O)c2c(O)cc(O)c(C3CCN(C)CC3O)c2o1.
What is the InChIKey of 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one?
The InChIKey is MXQMYWXBECXGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO5S/c1-3-24-14-7-12(21)16-11(20)6-10(19)15(17(16)23-14)9-4-5-18(2)8-13(9)22/h6-7,9,13,19-20,22H,3-5,8H2,1-2H3.
What are the key properties of 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one?
2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one has a molecular weight of 351.42 g/mol, XLogP of 2.10, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)chromen-4-one is sourced from PubChem (CID 5329713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).