About Glutathioselenol
Glutathioselenol (PubChem CID 53297413) has the molecular formula C10H16N3O6SSe
and a molecular weight of 385.28 g/mol.
Molecular Properties
| Compound Name | Glutathioselenol |
| PubChem CID | 53297413 |
| Molecular Formula | C10H16N3O6SSe |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS[Se])C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N3O6SSe/c11-5(10(18)19)1-2-7(14)13-6(4-20-21)9(17)12-3-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | KAWPMBUMOSHIOP-WDSKDSINSA-N |
| XLogP | -2.32 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Glutathioselenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Glutathioselenol?
The IUPAC name of Glutathioselenol (CID 53297413) is not available.
What is the SMILES notation for Glutathioselenol?
The canonical SMILES for Glutathioselenol is N[C@@H](CCC(=O)N[C@@H](CS[Se])C(=O)NCC(=O)O)C(=O)O.
What is the InChIKey of Glutathioselenol?
The InChIKey is KAWPMBUMOSHIOP-WDSKDSINSA-N. The full InChI is InChI=1S/C10H16N3O6SSe/c11-5(10(18)19)1-2-7(14)13-6(4-20-21)9(17)12-3-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1.
What are the key properties of Glutathioselenol?
Glutathioselenol has a molecular weight of 385.28 g/mol, XLogP of -2.32, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Glutathioselenol is sourced from PubChem (CID 53297413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).