About ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate
ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 53297538) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| PubChem CID | 53297538 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C#N)c(SCC(=O)c2ccc(C)cc2C)nc1N |
| InChI | InChI=1S/C19H19N3O3S/c1-4-25-19(24)15-8-13(9-20)18(22-17(15)21)26-10-16(23)14-6-5-11(2)7-12(14)3/h5-8H,4,10H2,1-3H3,(H2,21,22) |
| InChIKey | VZTOLGUQSBVNJC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate?
The IUPAC name of ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate (CID 53297538) is ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate?
The canonical SMILES for ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate is CCOC(=O)c1cc(C#N)c(SCC(=O)c2ccc(C)cc2C)nc1N.
What is the InChIKey of ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate?
The InChIKey is VZTOLGUQSBVNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3S/c1-4-25-19(24)15-8-13(9-20)18(22-17(15)21)26-10-16(23)14-6-5-11(2)7-12(14)3/h5-8H,4,10H2,1-3H3,(H2,21,22).
What are the key properties of ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate?
ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate has a molecular weight of 369.45 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-5-cyano-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanylpyridine-3-carboxylate is sourced from PubChem (CID 53297538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).