C16H27ClN2OS — CID 53297740
N,N-diethyl-3-[(Z)-5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylideneamino]oxypropan-1-amine;hydrochloride (PubChem CID 53297740) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is N,N-diethyl-3-[(Z)-5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylideneamino]oxypropan-1-amine;hydrochloride.
| Compound Name | N,N-diethyl-3-[(Z)-5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylideneamino]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 53297740 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N,N-diethyl-3-[(Z)-5,6,7,8-tetrahydrocyclohepta[b]thiophen-4-ylideneamino]oxypropan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCO/N=C1/CCCCc2sccc21.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-3-18(4-2)11-7-12-19-17-15-8-5-6-9-16-14(15)10-13-20-16;/h10,13H,3-9,11-12H2,1-2H3;1H/b17-15-; |
| InChIKey | YLNYHAJJDBKHKF-NYDCQJDFSA-N |
| XLogP | 4.35 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|