C20H34F7NO — CID 532978
N,N-bis(2-ethylhexyl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 532978) has the molecular formula C20H34F7NO and a molecular weight of 437.48 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N,N-bis(2-ethylhexyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 532978 |
| Molecular Formula | C20H34F7NO |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H34F7NO/c1-5-9-11-15(7-3)13-28(14-16(8-4)12-10-6-2)17(29)18(21,22)19(23,24)20(25,26)27/h15-16H,5-14H2,1-4H3 |
| InChIKey | DRDRAZUGOVAKNM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|