About Urea deriv. 35
Urea deriv. 35 (PubChem CID 5329841) has the molecular formula C32H38N8O3S
and a molecular weight of 614.80 g/mol. Its IUPAC name is 1-[4-[methyl-[2-[4-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]phenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea.
Molecular Properties
| Compound Name | Urea deriv. 35 |
| PubChem CID | 5329841 |
| Molecular Formula | C32H38N8O3S |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 1-[4-[methyl-[2-[4-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]phenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)NC(=O)NC3=CC=C(C=C3)N(C)C4=NC(=NC=C4)NC5=CC=C(C=C5)CS(=O)(=O)C |
| InChI | InChI=1S/C32H38N8O3S/c1-38-18-20-40(21-19-38)22-24-4-8-27(9-5-24)35-32(41)36-28-12-14-29(15-13-28)39(2)30-16-17-33-31(37-30)34-26-10-6-25(7-11-26)23-44(3,42)43/h4-17H,18-23H2,1-3H3,(H,33,34,37)(H2,35,36,41) |
| InChIKey | WUUXQSKAAWHECK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | 980 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze Urea deriv. 35 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Urea deriv. 35?
The IUPAC name of Urea deriv. 35 (CID 5329841) is 1-[4-[methyl-[2-[4-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]amino]phenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea.
What is the SMILES notation for Urea deriv. 35?
The canonical SMILES for Urea deriv. 35 is CN1CCN(CC1)CC2=CC=C(C=C2)NC(=O)NC3=CC=C(C=C3)N(C)C4=NC(=NC=C4)NC5=CC=C(C=C5)CS(=O)(=O)C.
What is the InChIKey of Urea deriv. 35?
The InChIKey is WUUXQSKAAWHECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H38N8O3S/c1-38-18-20-40(21-19-38)22-24-4-8-27(9-5-24)35-32(41)36-28-12-14-29(15-13-28)39(2)30-16-17-33-31(37-30)34-26-10-6-25(7-11-26)23-44(3,42)43/h4-17H,18-23H2,1-3H3,(H,33,34,37)(H2,35,36,41).
What are the key properties of Urea deriv. 35?
Urea deriv. 35 has a molecular weight of 614.80 g/mol, XLogP of 3.50, 10 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for Urea deriv. 35 is sourced from PubChem (CID 5329841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).