C23H44O5Si — CID 53298433
cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-(2-methoxyethoxymethoxy)oct-1-enyl]cyclopentan-1-one (PubChem CID 53298433) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-(2-methoxyethoxymethoxy)oct-1-enyl]cyclopentan-1-one.
| Compound Name | cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-(2-methoxyethoxymethoxy)oct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 53298433 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-(2-methoxyethoxymethoxy)oct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](/C=C/[C@@H]1CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C23H44O5Si/c1-8-9-10-11-21(27-18-26-15-14-25-5)13-12-19-16-20(24)17-22(19)28-29(6,7)23(2,3)4/h12-13,19,21-22H,8-11,14-18H2,1-7H3/b13-12+/t19-,21-,22-/m1/s1 |
| InChIKey | UOHYGYKCCYPZLJ-OUXKXGBHSA-N |
| XLogP | 5.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|