C18H18N2O4 — CID 5329854
5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-oxazol-2-amine (PubChem CID 5329854) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-oxazol-2-amine.
| Compound Name | 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 5329854 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3-oxazol-2-amine |
| SMILES | COc1cc(Nc2ncc(-c3ccccc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-21-14-9-13(10-15(22-2)17(14)23-3)20-18-19-11-16(24-18)12-7-5-4-6-8-12/h4-11H,1-3H3,(H,19,20) |
| InChIKey | CKYLEUNHWFIYOR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |