About 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea
1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 5329888) has the molecular formula C22H16F3N3O2
and a molecular weight of 411.38 g/mol. Its IUPAC name is 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| PubChem CID | 5329888 |
| Molecular Formula | C22H16F3N3O2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2cccc3c2CNC3=O)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N3O2/c23-22(24,25)14-3-1-4-16(11-14)28-21(30)27-15-9-7-13(8-10-15)17-5-2-6-18-19(17)12-26-20(18)29/h1-11H,12H2,(H,26,29)(H2,27,28,30) |
| InChIKey | HVLQSTLIXZZWIR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (CID 5329888) is 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea is O=C(Nc1ccc(-c2cccc3c2CNC3=O)cc1)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The InChIKey is HVLQSTLIXZZWIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F3N3O2/c23-22(24,25)14-3-1-4-16(11-14)28-21(30)27-15-9-7-13(8-10-15)17-5-2-6-18-19(17)12-26-20(18)29/h1-11H,12H2,(H,26,29)(H2,27,28,30).
What are the key properties of 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea has a molecular weight of 411.38 g/mol, XLogP of 5.26, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 5329888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).