C23H21N3O2 — CID 5329895
1-(3,4-dimethylphenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea (PubChem CID 5329895) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 5329895 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3cccc4c3CNC4=O)cc2)cc1C |
| InChI | InChI=1S/C23H21N3O2/c1-14-6-9-18(12-15(14)2)26-23(28)25-17-10-7-16(8-11-17)19-4-3-5-20-21(19)13-24-22(20)27/h3-12H,13H2,1-2H3,(H,24,27)(H2,25,26,28) |
| InChIKey | VCSQVKQFGYRGEH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |