About 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea
1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 5329905) has the molecular formula C22H18ClN3O2
and a molecular weight of 391.86 g/mol. Its IUPAC name is 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea |
| PubChem CID | 5329905 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3cccc4c3CNC4=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H18ClN3O2/c1-13-4-2-5-14(10-13)25-22(28)26-15-8-9-17(20(23)11-15)16-6-3-7-18-19(16)12-24-21(18)27/h2-11H,12H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | OLTBLEXDHJLGOW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea?
The IUPAC name of 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea (CID 5329905) is 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea.
What is the SMILES notation for 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea?
The canonical SMILES for 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea is Cc1cccc(NC(=O)Nc2ccc(-c3cccc4c3CNC4=O)c(Cl)c2)c1.
What is the InChIKey of 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea?
The InChIKey is OLTBLEXDHJLGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClN3O2/c1-13-4-2-5-14(10-13)25-22(28)26-15-8-9-17(20(23)11-15)16-6-3-7-18-19(16)12-24-21(18)27/h2-11H,12H2,1H3,(H,24,27)(H2,25,26,28).
What are the key properties of 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea?
1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea has a molecular weight of 391.86 g/mol, XLogP of 5.20, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea is sourced from PubChem (CID 5329905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).