About 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea
1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 53299113) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea |
| PubChem CID | 53299113 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1scc(CCNC(=O)NCC2CCCO2)c1C |
| InChI | InChI=1S/C14H22N2O2S/c1-10-11(2)19-9-12(10)5-6-15-14(17)16-8-13-4-3-7-18-13/h9,13H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | PGLLQNULBWOGRW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea?
The IUPAC name of 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea (CID 53299113) is 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea.
What is the SMILES notation for 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea?
The canonical SMILES for 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea is Cc1scc(CCNC(=O)NCC2CCCO2)c1C.
What is the InChIKey of 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea?
The InChIKey is PGLLQNULBWOGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2S/c1-10-11(2)19-9-12(10)5-6-15-14(17)16-8-13-4-3-7-18-13/h9,13H,3-8H2,1-2H3,(H2,15,16,17).
What are the key properties of 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea?
1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea has a molecular weight of 282.41 g/mol, XLogP of 2.39, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(oxolan-2-ylmethyl)urea is sourced from PubChem (CID 53299113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).