About N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide
N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 53299115) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide |
| PubChem CID | 53299115 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)NC2CCCC2)cn1C |
| InChI | InChI=1S/C10H17N3O2S/c1-8-11-10(7-13(8)2)16(14,15)12-9-5-3-4-6-9/h7,9,12H,3-6H2,1-2H3 |
| InChIKey | BJKRQEISHWVWFC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide?
The IUPAC name of N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide (CID 53299115) is N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide.
What is the SMILES notation for N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide?
The canonical SMILES for N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide is Cc1nc(S(=O)(=O)NC2CCCC2)cn1C.
What is the InChIKey of N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide?
The InChIKey is BJKRQEISHWVWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-8-11-10(7-13(8)2)16(14,15)12-9-5-3-4-6-9/h7,9,12H,3-6H2,1-2H3.
What are the key properties of N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide?
N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide has a molecular weight of 243.33 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1,2-dimethylimidazole-4-sulfonamide is sourced from PubChem (CID 53299115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).