C23H27ClF3N3O2S — CID 53299548
2-(3-butan-2-ylsulfanylphenyl)-N-butyl-6-chloroimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 53299548) has the molecular formula C23H27ClF3N3O2S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-(3-butan-2-ylsulfanylphenyl)-N-butyl-6-chloroimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3-butan-2-ylsulfanylphenyl)-N-butyl-6-chloroimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53299548 |
| Molecular Formula | C23H27ClF3N3O2S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-(3-butan-2-ylsulfanylphenyl)-N-butyl-6-chloroimidazo[1,2-a]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1c(-c2cccc(SC(C)CC)c2)nc2ccc(Cl)cn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26ClN3S.C2HF3O2/c1-4-6-12-23-21-20(24-19-11-10-17(22)14-25(19)21)16-8-7-9-18(13-16)26-15(3)5-2;3-2(4,5)1(6)7/h7-11,13-15,23H,4-6,12H2,1-3H3;(H,6,7) |
| InChIKey | BHZRAWLSAGRPME-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|