C19H23N5O6 — CID 53299551
1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[4-(pyridin-2-ylmethyl)piperazine-1-carbonyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 53299551) has the molecular formula C19H23N5O6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[4-(pyridin-2-ylmethyl)piperazine-1-carbonyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[4-(pyridin-2-ylmethyl)piperazine-1-carbonyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53299551 |
| Molecular Formula | C19H23N5O6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[4-(pyridin-2-ylmethyl)piperazine-1-carbonyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C([C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C19H23N5O6/c25-13-4-6-24(19(29)21-13)18-15(27)14(26)16(30-18)17(28)23-9-7-22(8-10-23)11-12-3-1-2-5-20-12/h1-6,14-16,18,26-27H,7-11H2,(H,21,25,29)/t14-,15+,16-,18+/m0/s1 |
| InChIKey | AQWWCVDCLXZVNX-UIBIWLFHSA-N |
| XLogP | -2.10 |
| TPSA | 140.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |