C21H26FN5O5 — CID 53299554
4-amino-1-[(2R,3R,4S,5S)-5-[4-[(2-fluorophenyl)methyl]-1,4-diazepane-1-carbonyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 53299554) has the molecular formula C21H26FN5O5 and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5S)-5-[4-[(2-fluorophenyl)methyl]-1,4-diazepane-1-carbonyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5S)-5-[4-[(2-fluorophenyl)methyl]-1,4-diazepane-1-carbonyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 53299554 |
| Molecular Formula | C21H26FN5O5 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5S)-5-[4-[(2-fluorophenyl)methyl]-1,4-diazepane-1-carbonyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@H](C(=O)N3CCCN(Cc4ccccc4F)CC3)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C21H26FN5O5/c22-14-5-2-1-4-13(14)12-25-7-3-8-26(11-10-25)19(30)18-16(28)17(29)20(32-18)27-9-6-15(23)24-21(27)31/h1-2,4-6,9,16-18,20,28-29H,3,7-8,10-12H2,(H2,23,24,31)/t16-,17+,18-,20+/m0/s1 |
| InChIKey | GDORTWQUNCAWSI-HLNWXESRSA-N |
| XLogP | -0.68 |
| TPSA | 134.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |