About trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione
trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione (PubChem CID 53299559) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione.
Molecular Properties
| Compound Name | trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione |
| PubChem CID | 53299559 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione |
| SMILES | O=C1CCCCCC(=O)[C@H](O)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H20O4/c17-13-9-5-2-6-10-16(19)20-15(11-14(13)18)12-7-3-1-4-8-12/h1,3-4,7-8,14-15,18H,2,5-6,9-11H2/t14-,15-/m1/s1 |
| InChIKey | QMMGPVBDSMILTN-HUUCEWRRSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione?
The IUPAC name of trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione (CID 53299559) is trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione.
What is the SMILES notation for trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione?
The canonical SMILES for trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione is O=C1CCCCCC(=O)[C@H](O)C[C@H](c2ccccc2)O1.
What is the InChIKey of trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione?
The InChIKey is QMMGPVBDSMILTN-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H20O4/c17-13-9-5-2-6-10-16(19)20-15(11-14(13)18)12-7-3-1-4-8-12/h1,3-4,7-8,14-15,18H,2,5-6,9-11H2/t14-,15-/m1/s1.
What are the key properties of trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione?
trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione has a molecular weight of 276.33 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(9R,11R)-9-hydroxy-11-phenyl-oxacycloundecane-2,8-dione is sourced from PubChem (CID 53299559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).