C31H52N4O4 — CID 53299703
(5S)-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(cyclohexylmethyl)-5-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 53299703) has the molecular formula C31H52N4O4 and a molecular weight of 544.78 g/mol. Its IUPAC name is (5S)-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(cyclohexylmethyl)-5-(2-methylpropyl)piperazine-2,3-dione.
| Compound Name | (5S)-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(cyclohexylmethyl)-5-(2-methylpropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 53299703 |
| Molecular Formula | C31H52N4O4 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | (5S)-1-[4-[(2S)-1-(2-cyclohexylethyl)-5,6-dioxopiperazin-2-yl]butyl]-4-(cyclohexylmethyl)-5-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CN(CCCC[C@H]2CNC(=O)C(=O)N2CCC2CCCCC2)C(=O)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C31H52N4O4/c1-23(2)19-27-22-33(30(38)31(39)35(27)21-25-13-7-4-8-14-25)17-10-9-15-26-20-32-28(36)29(37)34(26)18-16-24-11-5-3-6-12-24/h23-27H,3-22H2,1-2H3,(H,32,36)/t26-,27-/m0/s1 |
| InChIKey | AJNBAHVUOGJOFY-SVBPBHIXSA-N |
| XLogP | 4.12 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|