C17H20N2O2S — CID 53299732
7-methyl-5-(4-propan-2-ylphenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 53299732) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 7-methyl-5-(4-propan-2-ylphenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-5-(4-propan-2-ylphenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 53299732 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 7-methyl-5-(4-propan-2-ylphenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | CC1Cc2[nH]c(=S)[nH]c(=O)c2C(c2ccc(C(C)C)cc2)O1 |
| InChI | InChI=1S/C17H20N2O2S/c1-9(2)11-4-6-12(7-5-11)15-14-13(8-10(3)21-15)18-17(22)19-16(14)20/h4-7,9-10,15H,8H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | YJENHNDDEBGZTR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|