C30H29F3N4O4 — CID 53299845
(3S)-4-[3-(1-benzofuran-2-yl)phenyl]-3-(2-hydroxyethyl)-2-N-propan-2-yl-6-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxamide (PubChem CID 53299845) has the molecular formula C30H29F3N4O4 and a molecular weight of 566.58 g/mol. Its IUPAC name is (3S)-4-[3-(1-benzofuran-2-yl)phenyl]-3-(2-hydroxyethyl)-2-N-propan-2-yl-6-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxamide.
| Compound Name | (3S)-4-[3-(1-benzofuran-2-yl)phenyl]-3-(2-hydroxyethyl)-2-N-propan-2-yl-6-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 53299845 |
| Molecular Formula | C30H29F3N4O4 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (3S)-4-[3-(1-benzofuran-2-yl)phenyl]-3-(2-hydroxyethyl)-2-N-propan-2-yl-6-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxamide |
| SMILES | CC(C)NC(=O)N1Cc2cc(C(=O)NCC(F)(F)F)nc(-c3cccc(-c4cc5ccccc5o4)c3)c2[C@@H]1CCO |
| InChI | InChI=1S/C30H29F3N4O4/c1-17(2)35-29(40)37-15-21-13-22(28(39)34-16-30(31,32)33)36-27(26(21)23(37)10-11-38)20-8-5-7-18(12-20)25-14-19-6-3-4-9-24(19)41-25/h3-9,12-14,17,23,38H,10-11,15-16H2,1-2H3,(H,34,39)(H,35,40)/t23-/m0/s1 |
| InChIKey | WUGUQQZCGONQFT-QHCPKHFHSA-N |
| XLogP | 5.81 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |