C32H38N2O4 — CID 53300082
methyl (3S,4aS)-1-benzyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate (PubChem CID 53300082) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is methyl (3S,4aS)-1-benzyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate.
| Compound Name | methyl (3S,4aS)-1-benzyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 53300082 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | methyl (3S,4aS)-1-benzyl-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCCC=C1N(Cc1ccccc1)C(=O)[C@H](CC(=O)N1CCC(c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C32H38N2O4/c1-38-31(37)32-18-10-4-9-15-28(32)34(23-24-11-5-2-6-12-24)30(36)27(22-32)21-29(35)33-19-16-26(17-20-33)25-13-7-3-8-14-25/h2-3,5-8,11-15,26-27H,4,9-10,16-23H2,1H3/t27-,32+/m1/s1 |
| InChIKey | CRAZWLSOQKVTDT-ZUKKLESISA-N |
| XLogP | 5.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |